Products 1557187-54-8

CAS 1557187-54-8 is the registry number for tert-Butyl 4-aminooxane-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-aminooxane-4-carboxylate (CAS 1557187-54-8) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl 4-aminooxane-4-carboxylate. InChIKey: HOOONDHSNFGMTF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO3
Molecular weight201.26 g/mol
IUPAC nametert-butyl 4-aminooxane-4-carboxylate
InChIKeyHOOONDHSNFGMTF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1(CCOCC1)N

Computed by PubChem (NCBI)