CAS 155723-62-9 is the registry number for rac-(1R,5S)-5-Amino-3,3-dimethylcyclohexan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-(1S,5R)-5-amino-3,3-dimethylcyclohexan-1-ol (CAS 155723-62-9) is a chemical compound with the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. IUPAC name: cis-(1S,5R)-5-amino-3,3-dimethylcyclohexan-1-ol. InChIKey: VPTMLCZYRTULJD-NKWVEPMBSA-N.
| Molecular formula | C8H17NO |
|---|---|
| Molecular weight | 143.23 g/mol |
| IUPAC name | cis-(1S,5R)-5-amino-3,3-dimethylcyclohexan-1-ol |
| InChIKey | VPTMLCZYRTULJD-NKWVEPMBSA-N |
| SMILES | CC1(C[C@H](C[C@H](C1)O)N)C |
Computed by PubChem (NCBI)