CAS 15574-09-1 appears in our catalog under these names: Ammonium succinate(1:x) 98%, Butanedioic acid, ammonium salt, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
Diazanium;butanedioate (CAS 15574-09-1) is a chemical compound with the molecular formula C4H12N2O4 and a molecular weight of 152.15 g/mol. IUPAC name: diazanium;butanedioate. InChIKey: NHJPVZLSLOHJDM-UHFFFAOYSA-N.
| Molecular formula | C4H12N2O4 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | diazanium;butanedioate |
| InChIKey | NHJPVZLSLOHJDM-UHFFFAOYSA-N |
| SMILES | C(CC(=O)[O-])C(=O)[O-].[NH4+].[NH4+] |
Computed by PubChem (NCBI)