CAS 155778-36-2 appears in our catalog under these names: 2-Amino-5,6,7,8-tetrahydro-4h-thiazolo[5,4-c]azepin-4-one, 95%, 2-Amino-5,6,7,8-tetrahydro-4H-thiazolo(5,4-c)azepin-4-one, 97%, 2-Amino-4H,5H,6H,7H,8H-(1,3)thiazolo(5,4-c)azepin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 50mg, 0,5g.
2-amino-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-4-one (CAS 155778-36-2) is a chemical compound with the molecular formula C7H9N3OS and a molecular weight of 183.23 g/mol. IUPAC name: 2-amino-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-4-one. InChIKey: FUEGOTSBXHYYIY-UHFFFAOYSA-N.
| Molecular formula | C7H9N3OS |
|---|---|
| Molecular weight | 183.23 g/mol |
| IUPAC name | 2-amino-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-4-one |
| InChIKey | FUEGOTSBXHYYIY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)NC1)SC(=N2)N |
Computed by PubChem (NCBI)