CAS 15578-26-4 appears in our catalog under these names: Stannous pyrophosphate, 95%, Tin(II) Pyrophosphate, Tin(II)pyrophosphate, Tin(II) pyrophosphate , Stannous pyrophosphate 98%. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 25g, 100g, 1g, 5g, 2g, 500mg, 500g, 50g.
Phosphonato phosphate;bis(tin(2+)) (CAS 15578-26-4) is a chemical compound with the molecular formula O7P2Sn2 and a molecular weight of 411.36 g/mol. IUPAC name: phosphonato phosphate;bis(tin(2+)). InChIKey: GEZAUFNYMZVOFV-UHFFFAOYSA-J.
| Molecular formula | O7P2Sn2 |
|---|---|
| Molecular weight | 411.36 g/mol |
| IUPAC name | phosphonato phosphate;bis(tin(2+)) |
| InChIKey | GEZAUFNYMZVOFV-UHFFFAOYSA-J |
| SMILES | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Sn+2].[Sn+2] |
Computed by PubChem (NCBI)