CAS 155797-99-2 appears in our catalog under these names: CITFP, Beta-CIT-FP. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 1mg, 2mg, 5mg, 10mg.
Methyl (1R,2S,3S,5S)-8-(3-fluoropropyl)-3-(4-iodophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 155797-99-2) is a chemical compound with the molecular formula C18H23FINO2 and a molecular weight of 431.3 g/mol. IUPAC name: methyl (1R,2S,3S,5S)-8-(3-fluoropropyl)-3-(4-iodophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: HXWLAJVUJSVENX-HZMVEIRTSA-N.
| Molecular formula | C18H23FINO2 |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | methyl (1R,2S,3S,5S)-8-(3-fluoropropyl)-3-(4-iodophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | HXWLAJVUJSVENX-HZMVEIRTSA-N |
| SMILES | COC(=O)[C@@H]1[C@H]2CC[C@H](N2CCCF)C[C@@H]1C3=CC=C(C=C3)I |
Computed by PubChem (NCBI)