CAS 155802-61-2 is the registry number for 5-Hydroxyimidacloprid, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
(NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-hydroxyimidazolidin-2-ylidene]nitramide (CAS 155802-61-2) is a chemical compound with the molecular formula C9H10ClN5O3 and a molecular weight of 271.66 g/mol. IUPAC name: (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-hydroxyimidazolidin-2-ylidene]nitramide. InChIKey: MATMQDMQFSFQHB-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN5O3 |
|---|---|
| Molecular weight | 271.66 g/mol |
| IUPAC name | (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-hydroxyimidazolidin-2-ylidene]nitramide |
| InChIKey | MATMQDMQFSFQHB-UHFFFAOYSA-N |
| SMILES | C1C(N(/C(=N/[N+](=O)[O-])/N1)CC2=CN=C(C=C2)Cl)O |
Computed by PubChem (NCBI)