CAS 1558048-86-4 is the registry number for Methyl-1-(tert-butyldimethylsilyl)-1H-indole-6-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
Methyl 1-[tert-butyl(dimethyl)silyl]indole-6-carboxylate (CAS 1558048-86-4) is a chemical compound with the molecular formula C16H23NO2Si and a molecular weight of 289.44 g/mol. IUPAC name: methyl 1-[tert-butyl(dimethyl)silyl]indole-6-carboxylate. InChIKey: HUGMQXJIOFKOCN-UHFFFAOYSA-N.
| Molecular formula | C16H23NO2Si |
|---|---|
| Molecular weight | 289.44 g/mol |
| IUPAC name | methyl 1-[tert-butyl(dimethyl)silyl]indole-6-carboxylate |
| InChIKey | HUGMQXJIOFKOCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)N1C=CC2=C1C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)