Products 1558053-95-4

CAS 1558053-95-4 is the registry number for Deferasirox Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-(4-oxo-1,3-benzoxazin-2-yl)phenyl] 2-phenylmethoxybenzoate (CAS 1558053-95-4) is a chemical compound with the molecular formula C28H19NO5 and a molecular weight of 449.5 g/mol. IUPAC name: [2-(4-oxo-1,3-benzoxazin-2-yl)phenyl] 2-phenylmethoxybenzoate. InChIKey: QHBKTYSDAOTUHT-UHFFFAOYSA-N.

Identity
Molecular formulaC28H19NO5
Molecular weight449.5 g/mol
IUPAC name[2-(4-oxo-1,3-benzoxazin-2-yl)phenyl] 2-phenylmethoxybenzoate
InChIKeyQHBKTYSDAOTUHT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=CC=C2C(=O)OC3=CC=CC=C3C4=NC(=O)C5=CC=CC=C5O4

Computed by PubChem (NCBI)