Products 15586-20-6

CAS 15586-20-6 is the registry number for 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)triphthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[4,6-bis(3,4-dicarboxyphenyl)-1,3,5-triazin-2-yl]phthalic acid (CAS 15586-20-6) is a chemical compound with the molecular formula C27H15N3O12 and a molecular weight of 573.4 g/mol. IUPAC name: 4-[4,6-bis(3,4-dicarboxyphenyl)-1,3,5-triazin-2-yl]phthalic acid. InChIKey: JOCXRBQAJLUWTR-UHFFFAOYSA-N.

Identity
Molecular formulaC27H15N3O12
Molecular weight573.4 g/mol
IUPAC name4-[4,6-bis(3,4-dicarboxyphenyl)-1,3,5-triazin-2-yl]phthalic acid
InChIKeyJOCXRBQAJLUWTR-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=NC(=NC(=N2)C3=CC(=C(C=C3)C(=O)O)C(=O)O)C4=CC(=C(C=C4)C(=O)O)C(=O)O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)