CAS 1558780-78-1 appears in our catalog under these names: tert-Butyl 3-bromo-2,6-dioxopiperidine-1-carboxylate, 98%, 3-Bromo-1-Boc-piperidine-2,6-dione, >97%, >97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g.
Tert-butyl 3-bromo-2,6-dioxopiperidine-1-carboxylate (CAS 1558780-78-1) is a chemical compound with the molecular formula C10H14BrNO4 and a molecular weight of 292.13 g/mol. IUPAC name: tert-butyl 3-bromo-2,6-dioxopiperidine-1-carboxylate. InChIKey: DUEZHSLFTSMAIB-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO4 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | tert-butyl 3-bromo-2,6-dioxopiperidine-1-carboxylate |
| InChIKey | DUEZHSLFTSMAIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC(C1=O)Br |
Computed by PubChem (NCBI)