Products 15589-31-8
CAS 15589-31-8 is the registry number for Terallethrin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) 2,2,3,3-tetramethylcyclopropane-1-carboxylate (CAS 15589-31-8) is a chemical compound with the molecular formula C17H24O3 and a molecular weight of 276.4 g/mol. IUPAC name: (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) 2,2,3,3-tetramethylcyclopropane-1-carboxylate. InChIKey: MIZYPRIEDMSCAC-UHFFFAOYSA-N.
| Molecular formula | C17H24O3 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
| InChIKey | MIZYPRIEDMSCAC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)CC1OC(=O)C2C(C2(C)C)(C)C)CC=C |
Computed by PubChem (NCBI)