Products 1559059-72-1
CAS 1559059-72-1 is the registry number for [(5-Fluoro-1h-indol-2-yl)methyl]methylamine sulfate (2:1), 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(5-fluoro-1H-indol-2-yl)-N-methylmethanamine;sulfuric acid (CAS 1559059-72-1) is a chemical compound with the molecular formula C10H13FN2O4S and a molecular weight of 276.29 g/mol. IUPAC name: 1-(5-fluoro-1H-indol-2-yl)-N-methylmethanamine;sulfuric acid. InChIKey: WWGBENHCKWZTBH-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O4S |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 1-(5-fluoro-1H-indol-2-yl)-N-methylmethanamine;sulfuric acid |
| InChIKey | WWGBENHCKWZTBH-UHFFFAOYSA-N |
| SMILES | CNCC1=CC2=C(N1)C=CC(=C2)F.OS(=O)(=O)O |
Computed by PubChem (NCBI)