CAS 1559059-84-5 is the registry number for 2-[4-(Trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid;hydrate (CAS 1559059-84-5) is a chemical compound with the molecular formula C11H8F3NO3S and a molecular weight of 291.25 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid;hydrate. InChIKey: NYMMKWJXRDAUSN-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO3S |
|---|---|
| Molecular weight | 291.25 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylic acid;hydrate |
| InChIKey | NYMMKWJXRDAUSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)C(F)(F)F.O |
Computed by PubChem (NCBI)