Products 155906-59-5
CAS 155906-59-5 is the registry number for 2-Hydroxy-5-(1-(4-hydroxyphenyl)-1-methylethyl)benzaldehyde. Offered by: TRC. Available pack sizes: 1g.
2-hydroxy-5-[2-(4-hydroxyphenyl)propan-2-yl]benzaldehyde (CAS 155906-59-5) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-hydroxy-5-[2-(4-hydroxyphenyl)propan-2-yl]benzaldehyde. InChIKey: MTKAHNZDHABBQM-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-hydroxy-5-[2-(4-hydroxyphenyl)propan-2-yl]benzaldehyde |
| InChIKey | MTKAHNZDHABBQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC(=C(C=C2)O)C=O |
Computed by PubChem (NCBI)