Products 155969-61-2
CAS 155969-61-2 appears in our catalog under these names: Baihuaqianhuoside/ 98%, Praeroside. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg, 20mg.
1-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one (CAS 155969-61-2) is a chemical compound with the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. IUPAC name: 1-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one. InChIKey: ZLJVCXLTFBUWGK-IBEHDNSVSA-N.
| Molecular formula | C16H22O8 |
|---|---|
| Molecular weight | 342.34 g/mol |
| IUPAC name | 1-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one |
| InChIKey | ZLJVCXLTFBUWGK-IBEHDNSVSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC |
Computed by PubChem (NCBI)