CAS 15600-01-8 appears in our catalog under these names: 1,1,2,2,3,3-Hexachloropropane, 95%, 1,1,2,2,3,3–Hexachloropropane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 1g, 5g.
1,1,2,2,3,3-hexachloropropane (CAS 15600-01-8) is a chemical compound with the molecular formula C3H2Cl6 and a molecular weight of 250.8 g/mol. IUPAC name: 1,1,2,2,3,3-hexachloropropane. InChIKey: HVCSXHFGNRDDQR-UHFFFAOYSA-N.
| Molecular formula | C3H2Cl6 |
|---|---|
| Molecular weight | 250.8 g/mol |
| IUPAC name | 1,1,2,2,3,3-hexachloropropane |
| InChIKey | HVCSXHFGNRDDQR-UHFFFAOYSA-N |
| SMILES | C(C(C(Cl)Cl)(Cl)Cl)(Cl)Cl |
Computed by PubChem (NCBI)