CAS 156006-28-9 appears in our catalog under these names: 3,4,5–Trifluorophenylmagnesium bromide, 3,4,5-TRIFLUOROPHENYLMAGNESIUM BROMIDE,&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 50ML.
Magnesium;1,2,3-trifluorobenzene-5-ide;bromide (CAS 156006-28-9) is a chemical compound with the molecular formula C6H2BrF3Mg and a molecular weight of 235.28 g/mol. IUPAC name: magnesium;1,2,3-trifluorobenzene-5-ide;bromide. InChIKey: FAANOBAJWDSCGM-UHFFFAOYSA-M.
| Molecular formula | C6H2BrF3Mg |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | magnesium;1,2,3-trifluorobenzene-5-ide;bromide |
| InChIKey | FAANOBAJWDSCGM-UHFFFAOYSA-M |
| SMILES | C1=[C-]C=C(C(=C1F)F)F.[Mg+2].[Br-] |
Computed by PubChem (NCBI)