CAS 15602-15-0 is the registry number for Magnesium 2-ethylhexanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Magnesium bis(2-ethylhexanoate) (CAS 15602-15-0) is a chemical compound with the molecular formula C16H30MgO4 and a molecular weight of 310.71 g/mol. IUPAC name: magnesium bis(2-ethylhexanoate). InChIKey: CGSNFLLWLBPMLH-UHFFFAOYSA-L.
| Molecular formula | C16H30MgO4 |
|---|---|
| Molecular weight | 310.71 g/mol |
| IUPAC name | magnesium bis(2-ethylhexanoate) |
| InChIKey | CGSNFLLWLBPMLH-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)