CAS 156061-08-4 is the registry number for Valganciclovir Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (CAS 156061-08-4) is a chemical compound with the molecular formula C24H24N4O4 and a molecular weight of 432.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: PTQRNADUYXCYJL-VXKWHMMOSA-N.
| Molecular formula | C24H24N4O4 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | PTQRNADUYXCYJL-VXKWHMMOSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CC3=CNC4=CC=CC=C43)C(=O)O |
Computed by PubChem (NCBI)