Products 1561-49-5

CAS 1561-49-5 is the registry number for Dicyclohexyl Peroxydicarbonate (Technical Grade). Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Cyclohexyl cyclohexyloxycarbonyloxy carbonate (CAS 1561-49-5) is a chemical compound with the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. IUPAC name: cyclohexyl cyclohexyloxycarbonyloxy carbonate. InChIKey: BLCKNMAZFRMCJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22O6
Molecular weight286.32 g/mol
IUPAC namecyclohexyl cyclohexyloxycarbonyloxy carbonate
InChIKeyBLCKNMAZFRMCJJ-UHFFFAOYSA-N
SMILESC1CCC(CC1)OC(=O)OOC(=O)OC2CCCCC2

Computed by PubChem (NCBI)