Products 156113-56-3
CAS 156113-56-3 appears in our catalog under these names: trans-4-(1H-1,2,3-Triazol-1-yl)pyrrolidin-3-ol hydrochloride, 95%, 95%, trans-4-(1H-1,2,3-Triazol-1-yl)pyrrolidin-3-ol hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3S,4S)-4-(triazol-1-yl)pyrrolidin-3-ol;hydrochloride (CAS 156113-56-3) is a chemical compound with the molecular formula C6H11ClN4O and a molecular weight of 190.63 g/mol. IUPAC name: (3S,4S)-4-(triazol-1-yl)pyrrolidin-3-ol;hydrochloride. InChIKey: QPOPOZYGTWDBTI-GEMLJDPKSA-N.
| Molecular formula | C6H11ClN4O |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | (3S,4S)-4-(triazol-1-yl)pyrrolidin-3-ol;hydrochloride |
| InChIKey | QPOPOZYGTWDBTI-GEMLJDPKSA-N |
| SMILES | C1[C@@H]([C@H](CN1)O)N2C=CN=N2.Cl |
Computed by PubChem (NCBI)