CAS 15614-67-2 is the registry number for Dioxobis(triphenylphosphine)platinum, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Dioxoplatinum;bis(triphenylphosphane) (CAS 15614-67-2) is a chemical compound with the molecular formula C36H30O2P2Pt and a molecular weight of 751.7 g/mol. IUPAC name: dioxoplatinum;bis(triphenylphosphane). InChIKey: RXRLLJPVHZLHRS-UHFFFAOYSA-N.
| Molecular formula | C36H30O2P2Pt |
|---|---|
| Molecular weight | 751.7 g/mol |
| IUPAC name | dioxoplatinum;bis(triphenylphosphane) |
| InChIKey | RXRLLJPVHZLHRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.O=[Pt]=O |
Computed by PubChem (NCBI)