CAS 156186-28-6 is the registry number for 1,10-Dichloroperfluorodecane, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
1,10-dichloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluorodecane (CAS 156186-28-6) is a chemical compound with the molecular formula C10Cl2F20 and a molecular weight of 570.98 g/mol. IUPAC name: 1,10-dichloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluorodecane. InChIKey: URMYIKJKCYYLMX-UHFFFAOYSA-N.
| Molecular formula | C10Cl2F20 |
|---|---|
| Molecular weight | 570.98 g/mol |
| IUPAC name | 1,10-dichloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluorodecane |
| InChIKey | URMYIKJKCYYLMX-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)