CAS 156198-94-6 is the registry number for Emtricitabine Phosphonic Acid. Offered by: TRC. Available pack sizes: 250mg.
[(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate (CAS 156198-94-6) is a chemical compound with the molecular formula C8H11FN3O6PS and a molecular weight of 327.23 g/mol. IUPAC name: [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate. InChIKey: WQOMZMVXTRGMHZ-NTSWFWBYSA-N.
| Molecular formula | C8H11FN3O6PS |
|---|---|
| Molecular weight | 327.23 g/mol |
| IUPAC name | [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | WQOMZMVXTRGMHZ-NTSWFWBYSA-N |
| SMILES | C1[C@H](O[C@H](S1)COP(=O)(O)O)N2C=C(C(=NC2=O)N)F |
Computed by PubChem (NCBI)