Products 1562244-77-2

CAS 1562244-77-2 is the registry number for (4-Methyl-1H-pyrazol-3-yl)boronic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(4-methyl-1H-pyrazol-5-yl)boronic acid (CAS 1562244-77-2) is a chemical compound with the molecular formula C4H7BN2O2 and a molecular weight of 125.92 g/mol. IUPAC name: (4-methyl-1H-pyrazol-5-yl)boronic acid. InChIKey: IVUNNICUBVWZDT-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7BN2O2
Molecular weight125.92 g/mol
IUPAC name(4-methyl-1H-pyrazol-5-yl)boronic acid
InChIKeyIVUNNICUBVWZDT-UHFFFAOYSA-N
SMILESB(C1=C(C=NN1)C)(O)O

Computed by PubChem (NCBI)