Products 1562418-90-9
CAS 1562418-90-9 is the registry number for 5-Bromo-2,2,3,3-tetramethyl-2,3-dihydrobenzofuran, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2,2,3,3-tetramethyl-1-benzofuran (CAS 1562418-90-9) is a chemical compound with the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. IUPAC name: 5-bromo-2,2,3,3-tetramethyl-1-benzofuran. InChIKey: KWGRRBHZAMUIJN-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 5-bromo-2,2,3,3-tetramethyl-1-benzofuran |
| InChIKey | KWGRRBHZAMUIJN-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)OC1(C)C)C |
Computed by PubChem (NCBI)