CAS 1563-97-9 is the registry number for Dimetridazole-carboxylic acid sodium. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
Sodium 1-methyl-5-nitroimidazole-2-carboxylate (CAS 1563-97-9) is a chemical compound with the molecular formula C5H4N3NaO4 and a molecular weight of 193.09 g/mol. IUPAC name: sodium 1-methyl-5-nitroimidazole-2-carboxylate. InChIKey: REQSOEKBVDIFMB-UHFFFAOYSA-M.
| Molecular formula | C5H4N3NaO4 |
|---|---|
| Molecular weight | 193.09 g/mol |
| IUPAC name | sodium 1-methyl-5-nitroimidazole-2-carboxylate |
| InChIKey | REQSOEKBVDIFMB-UHFFFAOYSA-M |
| SMILES | CN1C(=CN=C1C(=O)[O-])[N+](=O)[O-].[Na+] |
Computed by PubChem (NCBI)