CAS 1563957-23-2 is the registry number for Methyl 3-((2,5-difluorophenyl)sulfanyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (E)-3-(2,5-difluorophenyl)sulfanylprop-2-enoate (CAS 1563957-23-2) is a chemical compound with the molecular formula C10H8F2O2S and a molecular weight of 230.23 g/mol. IUPAC name: methyl (E)-3-(2,5-difluorophenyl)sulfanylprop-2-enoate. InChIKey: ZXPSFKVPARRZJG-SNAWJCMRSA-N.
| Molecular formula | C10H8F2O2S |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | methyl (E)-3-(2,5-difluorophenyl)sulfanylprop-2-enoate |
| InChIKey | ZXPSFKVPARRZJG-SNAWJCMRSA-N |
| SMILES | COC(=O)/C=C/SC1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)