CAS 1564018-37-6 is the registry number for (1S,2R,5S)-5-Methyl-2-(propan-2-yl)cyclohexan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-amine;hydrochloride (CAS 1564018-37-6) is a chemical compound with the molecular formula C10H22ClN and a molecular weight of 191.74 g/mol. IUPAC name: (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-amine;hydrochloride. InChIKey: XAKVMELMSQHWLY-JYNKJOSWSA-N.
| Molecular formula | C10H22ClN |
|---|---|
| Molecular weight | 191.74 g/mol |
| IUPAC name | (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-amine;hydrochloride |
| InChIKey | XAKVMELMSQHWLY-JYNKJOSWSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)N)C(C)C.Cl |
Computed by PubChem (NCBI)