CAS 156406-07-4 is the registry number for (1S,2R,4S)-2-Amino-4-hydroxycyclopentanecarboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
(1S,2R,4S)-2-amino-4-hydroxycyclopentane-1-carboxylic acid (CAS 156406-07-4) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: (1S,2R,4S)-2-amino-4-hydroxycyclopentane-1-carboxylic acid. InChIKey: NSGWHGZCFYZYMB-VAYJURFESA-N.
| Molecular formula | C6H11NO3 |
|---|---|
| Molecular weight | 145.16 g/mol |
| IUPAC name | (1S,2R,4S)-2-amino-4-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | NSGWHGZCFYZYMB-VAYJURFESA-N |
| SMILES | C1[C@@H](C[C@H]([C@H]1C(=O)O)N)O |
Computed by PubChem (NCBI)