CAS 156420-66-5 appears in our catalog under these names: 4,5-Dimethyl-3-hydroxy-2(5H)-furanone-13C2, >95% (GC), 4,5-Dimethyl-3-hydroxy-2(5H)-furanone-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
4-hydroxy-3-methyl-2-(113C)methyl-(213C)2H-furan-5-one (CAS 156420-66-5) is a chemical compound with the molecular formula C6H8O3 and a molecular weight of 130.11 g/mol. IUPAC name: 4-hydroxy-3-methyl-2-(113C)methyl-(213C)2H-furan-5-one. InChIKey: UNYNVICDCJHOPO-NDLBAUGKSA-N.
| Molecular formula | C6H8O3 |
|---|---|
| Molecular weight | 130.11 g/mol |
| IUPAC name | 4-hydroxy-3-methyl-2-(113C)methyl-(213C)2H-furan-5-one |
| InChIKey | UNYNVICDCJHOPO-NDLBAUGKSA-N |
| SMILES | CC1=C(C(=O)O[13CH]1[13CH3])O |
Computed by PubChem (NCBI)