Products 1564253-75-3
CAS 1564253-75-3 appears in our catalog under these names: PGN36, PGN36, 99.74%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 25 mg, 100 mg, 5 mg, 10 mg.
1-benzyl-3-(cyclohexylmethoxy)-5-nitroindazole (CAS 1564253-75-3) is a chemical compound with the molecular formula C21H23N3O3 and a molecular weight of 365.4 g/mol. IUPAC name: 1-benzyl-3-(cyclohexylmethoxy)-5-nitroindazole. InChIKey: VLMJWSVJQMZYSE-UHFFFAOYSA-N.
| Molecular formula | C21H23N3O3 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 1-benzyl-3-(cyclohexylmethoxy)-5-nitroindazole |
| InChIKey | VLMJWSVJQMZYSE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)COC2=NN(C3=C2C=C(C=C3)[N+](=O)[O-])CC4=CC=CC=C4 |
Computed by PubChem (NCBI)