CAS 1564270-40-1 is the registry number for 1-(4-Bromophenyl)-6,7-dimethoxy-3-methylisochromane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isochromene (CAS 1564270-40-1) is a chemical compound with the molecular formula C18H19BrO3 and a molecular weight of 363.2 g/mol. IUPAC name: 1-(4-bromophenyl)-6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isochromene. InChIKey: OOPDTFXTEABDJV-UHFFFAOYSA-N.
| Molecular formula | C18H19BrO3 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 1-(4-bromophenyl)-6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isochromene |
| InChIKey | OOPDTFXTEABDJV-UHFFFAOYSA-N |
| SMILES | CC1CC2=CC(=C(C=C2C(O1)C3=CC=C(C=C3)Br)OC)OC |
Computed by PubChem (NCBI)