CAS 1564273-11-5 is the registry number for 5,7-Dichloro-8-fluoropyrido[3,4-d]pyridazin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-8-fluoro-3H-pyrido[3,4-d]pyridazin-4-one (CAS 1564273-11-5) is a chemical compound with the molecular formula C7H2Cl2FN3O and a molecular weight of 234.01 g/mol. IUPAC name: 5,7-dichloro-8-fluoro-3H-pyrido[3,4-d]pyridazin-4-one. InChIKey: BYLMKFAFXXIDOE-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN3O |
|---|---|
| Molecular weight | 234.01 g/mol |
| IUPAC name | 5,7-dichloro-8-fluoro-3H-pyrido[3,4-d]pyridazin-4-one |
| InChIKey | BYLMKFAFXXIDOE-UHFFFAOYSA-N |
| SMILES | C1=NNC(=O)C2=C1C(=C(N=C2Cl)Cl)F |
Computed by PubChem (NCBI)