CAS 15644-80-1 appears in our catalog under these names: 2,8–Dimethyl–4–hydroxyquinoline, 2,8-Dimethylquinolin-4-ol 98%, 2,8-dimethyl-1,4-dihydroquinolin-4-one, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.
2,8-dimethyl-1H-quinolin-4-one (CAS 15644-80-1) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,8-dimethyl-1H-quinolin-4-one. InChIKey: QUHJYDMHDWSZIP-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,8-dimethyl-1H-quinolin-4-one |
| InChIKey | QUHJYDMHDWSZIP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C=C(N2)C |
Computed by PubChem (NCBI)