Products 1564628-51-8
CAS 1564628-51-8 appears in our catalog under these names: Ethyl 3-bromo-4-chloro-5-methylbenzoate, 95%, Ethyl 3-bromo-4-chloro-5-methylbenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 3-bromo-4-chloro-5-methylbenzoate (CAS 1564628-51-8) is a chemical compound with the molecular formula C10H10BrClO2 and a molecular weight of 277.54 g/mol. IUPAC name: ethyl 3-bromo-4-chloro-5-methylbenzoate. InChIKey: RRUYKCHAMRMOBB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO2 |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | ethyl 3-bromo-4-chloro-5-methylbenzoate |
| InChIKey | RRUYKCHAMRMOBB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)Cl)Br |
Computed by PubChem (NCBI)