Products 1564768-42-8
CAS 1564768-42-8 is the registry number for 1-(3-Ethylphenyl)-2,2-difluoroethanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(3-ethylphenyl)-2,2-difluoroethanone (CAS 1564768-42-8) is a chemical compound with the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. IUPAC name: 1-(3-ethylphenyl)-2,2-difluoroethanone. InChIKey: WJBWXQZPOIWQMD-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | 1-(3-ethylphenyl)-2,2-difluoroethanone |
| InChIKey | WJBWXQZPOIWQMD-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)C(=O)C(F)F |
Computed by PubChem (NCBI)