Products 1564926-24-4

CAS 1564926-24-4 appears in our catalog under these names: (1-Methylcyclopentyl)methanesulfonyl chloride, 95%, (1-Methylcyclopentyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

(1-methylcyclopentyl)methanesulfonyl chloride (CAS 1564926-24-4) is a chemical compound with the molecular formula C7H13ClO2S and a molecular weight of 196.70 g/mol. IUPAC name: (1-methylcyclopentyl)methanesulfonyl chloride. InChIKey: MATHPNGWMIRIFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClO2S
Molecular weight196.70 g/mol
IUPAC name(1-methylcyclopentyl)methanesulfonyl chloride
InChIKeyMATHPNGWMIRIFJ-UHFFFAOYSA-N
SMILESCC1(CCCC1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)