Products 1249267-54-6

CAS 1249267-54-6 is the registry number for 4-Methylcyclohexane-1-sulfonyl chloride 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-methylcyclohexane-1-sulfonyl chloride (CAS 1249267-54-6) is a chemical compound with the molecular formula C7H13ClO2S and a molecular weight of 196.70 g/mol. IUPAC name: 4-methylcyclohexane-1-sulfonyl chloride. InChIKey: BJYALKVVPOIVFB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClO2S
Molecular weight196.70 g/mol
IUPAC name4-methylcyclohexane-1-sulfonyl chloride
InChIKeyBJYALKVVPOIVFB-UHFFFAOYSA-N
SMILESCC1CCC(CC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)