CAS 1565089-25-9 is the registry number for 2-(Chloromethyl)-5,5,7,7-tetramethyl-4,5,6,7-tetrahydrobenzo(d)thiazole, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(chloromethyl)-5,5,7,7-tetramethyl-4,6-dihydro-1,3-benzothiazole (CAS 1565089-25-9) is a chemical compound with the molecular formula C12H18ClNS and a molecular weight of 243.80 g/mol. IUPAC name: 2-(chloromethyl)-5,5,7,7-tetramethyl-4,6-dihydro-1,3-benzothiazole. InChIKey: YAFOYQWSVIMFBR-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNS |
|---|---|
| Molecular weight | 243.80 g/mol |
| IUPAC name | 2-(chloromethyl)-5,5,7,7-tetramethyl-4,6-dihydro-1,3-benzothiazole |
| InChIKey | YAFOYQWSVIMFBR-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(C1)(C)C)SC(=N2)CCl)C |
Computed by PubChem (NCBI)