CAS 1565106-77-5 appears in our catalog under these names: 4-Chloro-1-(2,2,2-trifluoroethyl)-1H-1,3-benzodiazol-2-amine, 95%, 4-Chloro-1-(2,2,2-trifluoroethyl)-1H-1,3-benzodiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-chloro-1-(2,2,2-trifluoroethyl)benzimidazol-2-amine (CAS 1565106-77-5) is a chemical compound with the molecular formula C9H7ClF3N3 and a molecular weight of 249.62 g/mol. IUPAC name: 4-chloro-1-(2,2,2-trifluoroethyl)benzimidazol-2-amine. InChIKey: YNOWPSKNEWCZBD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3N3 |
|---|---|
| Molecular weight | 249.62 g/mol |
| IUPAC name | 4-chloro-1-(2,2,2-trifluoroethyl)benzimidazol-2-amine |
| InChIKey | YNOWPSKNEWCZBD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(N2CC(F)(F)F)N |
Computed by PubChem (NCBI)