Products 1565427-96-4

CAS 1565427-96-4 appears in our catalog under these names: (Adamantan-2-yl)methanesulfonyl chloride, 95%, (Adamantan-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2-adamantylmethanesulfonyl chloride (CAS 1565427-96-4) is a chemical compound with the molecular formula C11H17ClO2S and a molecular weight of 248.77 g/mol. IUPAC name: 2-adamantylmethanesulfonyl chloride. InChIKey: OMIYZADVVBWUAT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClO2S
Molecular weight248.77 g/mol
IUPAC name2-adamantylmethanesulfonyl chloride
InChIKeyOMIYZADVVBWUAT-UHFFFAOYSA-N
SMILESC1C2CC3CC1CC(C2)C3CS(=O)(=O)Cl

Computed by PubChem (NCBI)