CAS 1565428-15-0 appears in our catalog under these names: 2-(2,2-Difluoroethoxy)pyridine-3-sulfonyl chloride, 95%, 2-(2,2-Difluoroethoxy)pyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2,2-difluoroethoxy)pyridine-3-sulfonyl chloride (CAS 1565428-15-0) is a chemical compound with the molecular formula C7H6ClF2NO3S and a molecular weight of 257.64 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)pyridine-3-sulfonyl chloride. InChIKey: NHDLKROPXWIMNG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF2NO3S |
|---|---|
| Molecular weight | 257.64 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)pyridine-3-sulfonyl chloride |
| InChIKey | NHDLKROPXWIMNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCC(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)