CAS 156547-62-5 appears in our catalog under these names: Salbutamol Impurity J, Albuterol Related Compound B, 2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 25mg.
2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone (CAS 156547-62-5) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: 2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone. InChIKey: WHJAFZHZZCVHJI-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone |
| InChIKey | WHJAFZHZZCVHJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)CO |
Computed by PubChem (NCBI)