Products 1565518-00-4
CAS 1565518-00-4 is the registry number for tert-Butyl (4-bromo-2-methyl-3-oxobutan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(4-bromo-2-methyl-3-oxobutan-2-yl)carbamate (CAS 1565518-00-4) is a chemical compound with the molecular formula C10H18BrNO3 and a molecular weight of 280.16 g/mol. IUPAC name: tert-butyl N-(4-bromo-2-methyl-3-oxobutan-2-yl)carbamate. InChIKey: OXZNBSNGMMHCIO-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNO3 |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-2-methyl-3-oxobutan-2-yl)carbamate |
| InChIKey | OXZNBSNGMMHCIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)CBr |
Computed by PubChem (NCBI)