CAS 1565583-08-5 is the registry number for 6-Bromo-4-chloro-8-fluoroquinazoline, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.
6-bromo-4-chloro-8-fluoroquinazoline (CAS 1565583-08-5) is a chemical compound with the molecular formula C8H3BrClFN2 and a molecular weight of 261.48 g/mol. IUPAC name: 6-bromo-4-chloro-8-fluoroquinazoline. InChIKey: UGSXXGHWEGCZAG-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClFN2 |
|---|---|
| Molecular weight | 261.48 g/mol |
| IUPAC name | 6-bromo-4-chloro-8-fluoroquinazoline |
| InChIKey | UGSXXGHWEGCZAG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NC=N2)Cl)F)Br |
Computed by PubChem (NCBI)