Products 1565663-44-6

CAS 1565663-44-6 is the registry number for 3-(2-(tert-Butoxy)ethoxy)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propanoic acid (CAS 1565663-44-6) is a chemical compound with the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propanoic acid. InChIKey: ZPVVAPBOXJIRDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18O4
Molecular weight190.24 g/mol
IUPAC name3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propanoic acid
InChIKeyZPVVAPBOXJIRDQ-UHFFFAOYSA-N
SMILESCC(C)(C)OCCOCCC(=O)O

Computed by PubChem (NCBI)