CAS 1565922-84-0 appears in our catalog under these names: 6,6,8,8-Tetramethyl-1-azaspiro(3.5)nonane, 95%, 6,6,8,8-Tetramethyl-1-azaspiro(3.5)nonane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6,6,8,8-tetramethyl-1-azaspiro[3.5]nonane (CAS 1565922-84-0) is a chemical compound with the molecular formula C12H23N and a molecular weight of 181.32 g/mol. IUPAC name: 6,6,8,8-tetramethyl-1-azaspiro[3.5]nonane. InChIKey: BZVIWWCJPJGMIQ-UHFFFAOYSA-N.
| Molecular formula | C12H23N |
|---|---|
| Molecular weight | 181.32 g/mol |
| IUPAC name | 6,6,8,8-tetramethyl-1-azaspiro[3.5]nonane |
| InChIKey | BZVIWWCJPJGMIQ-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC2(C1)CCN2)(C)C)C |
Computed by PubChem (NCBI)