Products 156597-64-7
CAS 156597-64-7 is the registry number for (S)-1-(5-FLUORO-2-METHOXYPHENYL)ETHAN-1-OL, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg.
(1S)-1-(5-fluoro-2-methoxyphenyl)ethanol (CAS 156597-64-7) is a chemical compound with the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. IUPAC name: (1S)-1-(5-fluoro-2-methoxyphenyl)ethanol. InChIKey: VLBOHPCLXJIASU-LURJTMIESA-N.
| Molecular formula | C9H11FO2 |
|---|---|
| Molecular weight | 170.18 g/mol |
| IUPAC name | (1S)-1-(5-fluoro-2-methoxyphenyl)ethanol |
| InChIKey | VLBOHPCLXJIASU-LURJTMIESA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)F)OC)O |
Computed by PubChem (NCBI)